| Identification | |
| Name: | Benzonitrile,2,4,6-trimethyl- |
| Synonyms: | 1-Cyano-2,4,6-trimethylbenzene;2,4,6-Trimethylbenzonitrile;Mesitonitrile;Mesitylnitrile;b-Isodurylonitrile; |
| CAS: | 2571-52-0 |
| Molecular Formula: | C10H11N |
| Molecular Weight: | 145.20 |
| InChI: | InChI=1/C10H11N/c1-7-4-8(2)10(6-11)9(3)5-7/h4-5H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Melting Point: | 52-53°C |
| Flash Point: | 111.3°C |
| Boiling Point: | 79-80°C 2mm |
| Density: | 0.97g/cm3 |
| Refractive index: | 1.521 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 111.3°C |
| Safety Data | |
 |
|
