| Identification | |
| Name: | 2,3-Pyridinediamine,5-chloro- |
| Synonyms: | Pyridine,2,3-diamino-5-chloro- (6CI,8CI);2,3-Diamino-5-chloropyridine;5-Chloro-2,3-diaminopyridine;5-Chloro-2,3-pyridinediamine; |
| CAS: | 25710-20-7 |
| Molecular Formula: | C5H6ClN3 |
| Molecular Weight: | 143.57424 |
| InChI: | InChI=1S/C5H6ClN3/c6-3-1-4(7)5(8)9-2-3/h1-2H,7H2,(H2,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.447 g/cm3 |
| Water Solubility: | Freely soluble in hot water |
| Solubility: | Freely soluble in hot water |
| Appearance: | white to slightly yellow crystalline needles |
| Specification: |
2,3-Pyridinediamine,5-chloro- , its cas register number is 25710-20-7. It also can be called 5-Chloropyridine-2,3-diamine . 2,3-Pyridinediamine,5-chloro- (CAS NO.25710-20-7) should avoid the condition incompatible materials. It is not compatible with strong oxidizing agents. And also prevent it to broken down into hazardous decomposition products: hydrogen chloride, nitrogen oxides, carbon monoxide, carbon dioxide. However, its hazardous polymerization has not been reported. |
| Packinggroup: | III |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
