Identification |
Name: | 2H-Pyran-2-one,3-[7-(2,4-dimethoxyphenyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-yl]-4-hydroxy-6-methyl- |
Synonyms: | 3-[7-(2,4-Dimethoxyphenyl)-2,3,6,7-tetrahydro-[1,4]thiazepin-5-yl]-4-hydroxy-6-methylpyran-2-one;KF 38789 |
CAS: | 257292-29-8 |
Molecular Formula: | C19H21 N O5 S |
Molecular Weight: | 375.4387 |
InChI: | InChI=1/C19H21NO5S/c1-11-8-15(21)18(19(22)25-11)14-10-17(26-7-6-20-14)13-5-4-12(23-2)9-16(13)24-3/h4-5,8-9,17,20H,6-7,10H2,1-3H3/b18-14+ |
Molecular Structure: |
|
Properties |
Flash Point: | 298.2°C |
Boiling Point: | 569.5°Cat760mmHg |
Density: | 1.265g/cm3 |
Refractive index: | 1.583 |
Biological Activity: | Selective inhibitor of P-selectin-mediated cell adhesion (IC 50 = 1.97 μ M) that displays no effects on L-selectin- and E-selectin-mediated adhesion. Blocks P-selectin-mediated binding in vitro and leukocyte accumulation in vivo . |
Flash Point: | 298.2°C |
Safety Data |
|
|