| Identification |
| Name: | Poly(oxy-1,2-ethanediyl),a-(2-methyl-1-oxo-2-propen-1-yl)-w-hydroxy- |
| Synonyms: | Glycols,polyethylene, monomethacrylate (8CI);Methacrylic acid, esters with polyethyleneglycols (7CI);Poly(oxy-1,2-ethanediyl), a-(2-methyl-1-oxo-2-propenyl)-w-hydroxy- (9CI);Methacrylicacid, monoester with polyethylene glycol (8CI);Bisomer 550;Bisomer PEM 6E;Blemmer PE;Blemmer PE 200;Blemmer PE 30;Blemmer PE 350;Blemmer PE 400;Blemmer PE 90;Blemmer PEG 300;Blemmer PME 2000;CD 570;CD 571;HEM 10;HEM5;HEMA 10;HEMA 5;M 281;MA 100;MA 100 (polyoxyalkylene);MA 100A;MA 150;MA 150MF;MA 50;MA 50 (polyoxyalkylene);MPEM 400;Methacrylate 100;Methacrylate 50;New Frontier NF-Bisomer PEM 6E;PE 350;PE 90;PM 350G;PM90G;PP 1000;Poly(ethylene oxide) monomethacrylate;Polyethylene glycolmethacrylate;Polyethylene glycol monomethacrylate;Sartomer CD 570;SartomerCD 572;Sipomer HEM 20; |
| CAS: | 25736-86-1 |
| Molecular Formula: | (C2H4 O)n C4 H6 O2 |
| Molecular Weight: | 526.61 |
| InChI: | InChI=1/C6H10O3/c1-5(2)6(8)9-4-3-7/h7H,1,3-4H2,2H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | FP: -12 deg C |
| Flash Point: | >230 °F |
| Boiling Point: | >300°C |
| Density: | 1.105 g/mL at 25 °C |
| Refractive index: | n20/D 1.467 |
| Solubility: | Miscible with water and soluble in common org solvents |
| Flash Point: | >230 °F |
| Color: | Clear mobile liquid |
| Safety Data |
| |
 |
