| Identification | |
| Name: | 1,3-Isobenzofurandione, 3a,4,7,7a-tetrahydro-, polymer with 2,5-furandione and 1,2-propanediol |
| Synonyms: | 1,3-isobenzofurandione, 3a,4,7,7a-tetrahydro-, polymer with 2,5-furandione and;1,3-Isobenzofurandione, 3a,4,7,7a-tetrahydro-, polymer with 2,5-furandione and 1,2-propanediol;1,3-isobenzofurandione, 3a,4,7,7a-tetrahydro-, polymerwith 2,5-furandione and 1,2-propanediol;Unsaturated polyester resin (light-stable) (195);Unsaturated polyester resin 195 |
| CAS: | 25749-56-8 |
| Molecular Formula: | C15H18O8 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H8O3.C4H2O3.C3H8O2/c9-7-5-3-1-2-4-6(5)8(10)11-7;5-3-1-2-4(6)7-3;1-3(5)2-4/h1-2,5-6H,3-4H2;1-2H;3-5H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 148.2°C |
| Boiling Point: | 305.6°C at 760 mmHg |
| Flash Point: | 148.2°C |
| Safety Data | |
 |
|
