| Identification | |
| Name: | (S)-(+)-1-Phenyl-1,2-ethanediol |
| Synonyms: | 1,2-Ethanediol,1-phenyl-, (S)-;1,2-Ethanediol, 1-phenyl-, (S)-(+)- (8CI);(+)-(1S)-1-Phenyl-1,2-ethanediol;(+)-1-Phenyl-1,2-ethanediol;(+)-1-Phenylethylene glycol;(+)-Phenyl glycol;(+)-Phenylethane-1,2-diol;(+)-Phenylethylene glycol;(+)-Styrene glycol;(1S)-1-(Phenyl)ethane-1,2-diol;(2S)-2-Phenylethane-1,2-diol;(S)-(+)-Phenyl-1,2-ethanediol;(S)-1-Phenyl-1,2-ethanediol;(S)-1-Phenyl-2-hydroxyethanol;(S)-Phenylethane-1,2-diol;(S)-Styrene glycol; |
| CAS: | 25779-13-9 |
| Molecular Formula: | C8H10O2 |
| Molecular Weight: | 138.16 |
| InChI: | InChI=1/C8H10O2/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8-10H,6H2/t8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.17 g/cm3? |
| Alpha: | 66 o (C=1, CHLOROFORM) |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | white to light yellow crystal powder |
| Specification: |
(S)-(+)-1-Phenyl-1,2-ethanediol (CAS NO.25779-13-9), its Synonyms are (S)-(+)-alpha,beta-Dihydroxyethylbenzene ; (S)-alpha,beta-Dihydroxyethylbenzene ; s(+)-Phenylethylene glycol ; (S)-(+)-Phenyl-1,2-ethanediol ; (S)-(+)-Styreneglycol ; (S)-Styrene glycol ; (S)-(+)-1-Phenylethane-1,2-diol ; (S)-(+)-1-Phenylethanediol . It is white to light yellow crystal powder. |
| Safety Data | |
 |
|
