| Identification | |
| Name: | Butanoic acid,2-amino-4-(methylseleno)- |
| CAS: | 2578-28-1 |
| EINECS: | 215-977-0 |
| Molecular Formula: | C5H11 N O2 Se |
| Molecular Weight: | 196.13 |
| InChI: | InChI=1/C5H11NO2Se/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3283 |
| Density: | g/cm3 |
| Solubility: | 0.5 M HCl: 50 mg/mL |
| Specification: | colorless, faint smelling, glistening powder Safety Statements:20/21-28-45-60-61 20/21:When using, do not eat, drink or smoke 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | II |
| Storage Temperature: | −20°C |
| Color: | Transparent, hexagonal sheets or plates; metallic luster of cryst |
| Safety Data | |
 |
|
