| Identification |
| Name: | Boron,(N,N-diethylethanamine)trihydro-, (T-4)- |
| Synonyms: | Borazane,N,N,N-triethyl- (7CI); Ethanamine, N,N-diethyl-, compd. with borane (1:1);Triethylamine, compd. with borane (1:1) (6CI,8CI); Borane, compd. withN,N-diethylethanamine (1:1); Borane, compd. with triethylamine (1:1) (8CI);Ethanamine, N,N-diethyl-, boron complex; Borane adduct with triethylamine(1:1); Borane complex with triethylamine (1:1); Borane-triethylamine; NSC59740; Triethylamine borane (1:1); Triethylamine complex with borane (1:1);Triethylamine-borane; Trihydro(triethylamine)boron |
| CAS: | 25783-22-6 |
| Molecular Formula: | C6H18BN |
| Molecular Weight: | 244.390025 |
| InChI: | InChI=1S/C18H14/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16/h1-14H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D |
| Molecular Structure: |
 |
| Properties |
| Safety Data |
| |
 |
