Identification |
Name: | 2-Propenoic acid,esters,butyl ester,polymer with methyl 2-propenoate |
Synonyms: | 2-Propenoic acid, butyl ester, polymer with methyl 2-propenoate |
CAS: | 25852-39-5 |
Molecular Formula: | C11H18O4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C7H12O2.C4H6O2/c1-3-5-6-9-7(8)4-2;1-3-4(5)6-2/h4H,2-3,5-6H2,1H3;3H,1H2,2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 39.4°C |
Boiling Point: | 145.9°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 39.4°C |
Safety Data |
|
 |