| Identification | |
| Name: | Anthracene,9-(bromomethyl)-10-chloro- |
| Synonyms: | 10-Bromomethyl-9-chloroanthracene |
| CAS: | 25855-92-9 |
| Molecular Formula: | C15H10 Br Cl |
| Molecular Weight: | 305.61 |
| InChI: | InChI=1/C15H10BrCl/c16-9-14-10-5-1-3-7-12(10)15(17)13-8-4-2-6-11(13)14/h1-8H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 232.9°C |
| Boiling Point: | 441.1°Cat760mmHg |
| Density: | 1.534g/cm3 |
| Refractive index: | 1.73 |
| Specification: |
10-Bromomethyl-9-chloroanthracene , its cas register number is 25855-92-9. It also can be called 9-(Bromomethyl)-10-chloroanthracene ; and Anthracene, 9-(bromomethyl)-10-chloro- . |
| Flash Point: | 232.9°C |
| Safety Data | |
 |
|
