Identification |
Name: | 4-Pyridinamine,2,6-dichloro- |
Synonyms: | Pyridine,4-amino-2,6-dichloro- (6CI,7CI,8CI);(2,6-Dichloropyridin-4-yl)amine;2,6-Dichloro-4-aminopyridine;2,6-Dichloropyridin-4-amine;NSC 136573; |
CAS: | 2587-02-2 |
EINECS: | -0 |
Molecular Formula: | C5H4Cl2N2 |
Molecular Weight: | 163.01 |
InChI: | InChI=1/C5H4Cl2N2/c6-4-1-3(8)2-5(7)9-4/h1-2H,(H2,8,9) |
Molecular Structure: |
 |
Properties |
Density: | 1.497 g/cm3 |
Water Solubility: | insoluble in water |
Solubility: | insoluble in water |
Appearance: | white crystals |
Specification: | Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Storage Temperature: | Refrigerator |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |