| Identification | |
| Name: | 1-Hydroxybenzotriazole |
| Synonyms: | 1-Hydroxy-1H-benzotriazole; 1-Hydroxybenzotriazole anhydrous; HOBt; N-Hydroxybenzotriazole |
| CAS: | 2592-95-2 |
| EINECS: | 219-989-7 |
| Molecular Formula: | C6H5N3O |
| Molecular Weight: | 135.12 |
| InChI: | InChI=1/C6H5N3O/c10-9-6-4-2-1-3-5(6)7-8-9/h1-4,10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1325 |
| Density: | 1.51 g/cm3 |
| Stability: | Stable, but possible risk of explosion if heated under confinement. Flammable. |
| Refractive index: | n20/D 1.488 |
| Solubility: | Slightly soluble |
| Appearance: | white to light yellow powder |
| Specification: |
?1-Hydroxybenzotriazole (CAS NO.2592-95-2) is also named as 1-Hydroxy-1H-benzotriazole hydrate ; 1-Hydroxybenzotriazole hydrate ; 4-26-00-00095 (Beilstein Handbook Reference) ; BRN 0004515 ; Benzazimidol hydrate ; CCRIS 2605 ; N-Hydroxybenzotriazole hydrate?.?1-Hydroxybenzotriazole (CAS NO.2592-95-2) is?white to light yellow powder. It reacts with activated acyl groups to form activated molecules that are referred to as activated esters. These esters are insoluble (like the N-hydroxysuccinimide esters) and react with amines at ambient temperature to give amides. |
| Packinggroup: | III |
| HS Code: | 29339980 |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
