| Identification | |
| Name: | Selenonium, trimethyl-(8CI,9CI) |
| Synonyms: | Trimethylseleniumion; Trimethylselenonium; Trimethylselenonium ion |
| CAS: | 25930-79-4 |
| Molecular Formula: | C3H9 Se |
| Molecular Weight: | 124.08 |
| InChI: | InChI=1S/C3H9Se/c1-4(2)3/h1-3H3/q+1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Trimethylselenonium , its cas register number is 25930-79-4. It also can be called Trimethylselenium ion ; Trimethylselenonium ion ; and Selenonium, trimethyl- . |
| Flash Point: | °C |
| Safety Data | |
 |
|
