| Identification | |
| Name: | Benzenecarbohydrazonoylchloride, N-(2,4,6-trichlorophenyl)- |
| Synonyms: | Benzoylchloride, (2,4,6-trichlorophenyl)hydrazone (8CI); Benzoyl chloride,2,4,6-trichlorophenylhydrazones (2CI); Banamite; Banomite; U 27415 |
| CAS: | 25939-05-3 |
| Molecular Formula: | C13H8 Cl4 N2 |
| Molecular Weight: | 334.03 |
| InChI: | InChI=1/C13H8Cl4N2/c14-9-6-10(15)12(11(16)7-9)18-19-13(17)8-4-2-1-3-5-8/h1-7,18H/b19-13+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 202.1°C |
| Boiling Point: | 410.5°Cat760mmHg |
| Density: | 1.44g/cm3 |
| Refractive index: | 1.625 |
| Specification: |
Banamite , its cas register number is 25939-05-3. It also can be called N-(2,4,6-Trichlorophenyl)benzenecarbohydrazonoyl chloride ; Benzoyl chloride(2,4,6-trichlorophenyl)hydrazone ; and Benzenecarbohydrazonoyl chloride, N-(2,4,6-trichlorophenyl)- . |
| Flash Point: | 202.1°C |
| Safety Data | |
 |
|
