| Identification | |
| Name: | Ethanol,2-[(5-nitro-2-pyridinyl)amino]- |
| Synonyms: | Ethanol,2-[(5-nitro-2-pyridyl)amino]- (8CI);NSC 96622;2-[(5-nitro-2-pyridyl)amino]ethan-1-ol;2-[(5-nitropyridin-2-yl)amino]ethanol hydrochloride;2-[(5-nitro-2-pyridyl)amino]ethanol; |
| CAS: | 25948-12-3 |
| EINECS: | 247-358-6 |
| Molecular Formula: | C7H9N3O3 |
| Molecular Weight: | 183.1647 |
| InChI: | InChI=1/C7H9N3O3/c11-4-3-8-7-2-1-6(5-9-7)10(12)13/h1-2,5,11H,3-4H2,(H,8,9) |
| Molecular Structure: | ![(C7H9N3O3) Ethanol,2-[(5-nitro-2-pyridyl)amino]- (8CI);NSC 96622;2-[(5-nitro-2-pyridyl)amino]ethan-1-ol;2-[(5-n...](https://img1.guidechem.com/chem/e/dict/111/25948-12-3.jpg) |
| Properties | |
| Density: | 1.431 g/cm3 |
| Refractive index: | 1.649 |
| Specification: |
The 2-[(5-Nitro-2-pyridyl)amino]ethanol, with the cas registry number 25948-12-3 and EINECS registry number 247-358-6, has the systematic name and IUPAC name of 2-[(5-nitropyridin-2-yl)amino]ethanol. And the molecular formula of the chemical is C7H9N3O3. The characteristics of this chemical are as followings: (1)ACD/LogP: 0.85; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.85; (4)ACD/LogD (pH 7.4): 0.85; (5)ACD/BCF (pH 5.5): 2.6; (6)ACD/BCF (pH 7.4): 2.6; (7)ACD/KOC (pH 5.5): 68.91; (8)ACD/KOC (pH 7.4): 68.93; (9)#H bond acceptors: 6; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 71.18 Å2; (13)Index of Refraction: 1.649; (14)Molar Refractivity: 46.66 cm3; (15)Molar Volume: 127.9 cm3; (16)Polarizability: 18.5×10-24cm3; (17)Surface Tension: 71.6 dyne/cm; (18)Density: 1.431 g/cm3; (19)Flash Point: 196.9 °C; (20)Enthalpy of Vaporization: 68.86 kJ/mol; (21)Boiling Point: 401.9 °C at 760 mmHg; (22)Vapour Pressure: 3.5E-07 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
