| Identification | |
| Name: | D-Talose |
| Synonyms: | Talose, D-(8CI);D(+)-Talose;NSC 224293; |
| CAS: | 2595-98-4 |
| EINECS: | 219-996-5 |
| Molecular Formula: | C6H12O6 |
| Molecular Weight: | 180.15588 |
| InChI: | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.581 g/cm3 |
| Refractive index: | 22 ° (C=1, H2O) |
| Water Solubility: | H2O: 0.1 g/mL, clear, colorless |
| Solubility: | H2O: 0.1 g/mL, clear, colorless |
| Appearance: | white fine crystalline powder |
| Specification: | white fine crystalline powder Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Color: | Colorless crystals or white granular powder |
| Safety Data | |
 |
|
