Identification |
Name: | 2-Propenoic acid, 2-methyl-, dodecyl ester, polymer with 5-ethenyl-2-methylpyridine and octadecyl 2-methyl-2-propenoate |
Synonyms: | 2-Propenoic acid, 2-methyl-, dodecyl ester, polymer with 5-ethenyl-2-methylpyridine and octadecyl 2-methyl-2-propenoate;stearyl-lauryl methacrylates/ 2-methyl-5-vinylpyridine |
CAS: | 25951-19-3 |
Molecular Formula: | C46H81NO4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C22H42O2.C16H30O2.C8H9N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-22(23)21(2)3;1-4-5-6-7-8-9-10-11-12-13-14-18-16(17)15(2)3;1-3-8-5-4-7(2)9-6-8/h2,4-20H2,1,3H3;2,4-14H2,1,3H3;3-6H,1H2,2H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 185°C |
Boiling Point: | 414.3°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 185°C |
Safety Data |
|
|