| Identification | |
| Name: | Carbamic acid,N-acetyl-, ethyl ester |
| Synonyms: | Carbamicacid, acetyl-, ethyl ester (6CI,7CI,8CI,9CI); Acetylurethane; EthylN-acetylcarbamate; N-Acetylurethane; NSC 60212 |
| CAS: | 2597-54-8 |
| Molecular Formula: | C5H9 N O3 |
| Molecular Weight: | 131.15 |
| InChI: | InChI=1/C5H9NO3/c1-3-9-5(8)6-4(2)7/h3H2,1-2H3,(H,6,7,8) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.088g/cm3 |
| Refractive index: | 1.421 |
| Specification: |
N-Acetyl ethyl carbamate (CAS NO.2597-54-8) is also named as 4-03-00-00048 (Beilstein Handbook Reference) ; AI3-61910 ; Acetylurethane ; BRN 1704043 ; Ethyl N-acetylcarbamate ; N-Acetylurethane ; NSC 60212 ; Carbamic acid, acetyl-, ethyl ester . N-Acetyl ethyl carbamate (CAS NO.2597-54-8) is toxic. It is flammable. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | °C |
| Safety Data | |
 |
|
