| Identification | |
| Name: | Ethanone,1-(8-hydroxy-5-quinolinyl)- |
| Synonyms: | Ketone,8-hydroxy-5-quinolyl methyl (6CI,7CI,8CI); 5-Acetyl-8-hydroxyquinoline;5-Acetyl-8-quinolinol; 5-Acetyloxine; NSC 40901; NSC 523017; NSC 68447;Quinacetol |
| CAS: | 2598-31-4 |
| Molecular Formula: | C11H9 N O2 |
| Molecular Weight: | 187.21 |
| InChI: | InChI=1/C11H9NO2/c1-7(13)8-4-5-10(14)11-9(8)3-2-6-12-11/h2-6,14H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 205.7°C |
| Boiling Point: | 416.5°Cat760mmHg |
| Density: | 1.275g/cm3 |
| Refractive index: | 1.658 |
| Specification: | Pale Brown Solid |
| Report: |
8-Hydroxy-5-quinolyl methyl ketone (CAS NO.2598-31-4) was reported in IJPPAZ Indian Journal of Physiology and Pharmacology. |
| Flash Point: | 205.7°C |
| Storage Temperature: | Refrigerator |
| Safety Data | |
 |
|
