| Identification | |
| Name: | FRP 1 |
| Synonyms: | Phenol-resorcinol-formaldehyde resins;Formaldehyde, polymer with 1,3-benzenediol and phenol;Phenol, resorcin, formaldehyde polymer;Phenol, resorcin, formaldehyde resin;Phenol,resorcin,formaldehyde polymer;Phenol,resorcin,formaldehyde resin;Resorcinol, formaldehyde, phenol polymer;phenol/ resorcinol/ formaldehyde resin |
| CAS: | 25986-71-4 |
| Molecular Formula: | C13H14O4 |
| Molecular Weight: | 234.24786 |
| InChI: | InChI=1S/C6H6O2.C6H6O.CH2O/c7-5-2-1-3-6(8)4-5;7-6-4-2-1-3-5-6;1-2/h1-4,7-8H;1-5,7H;1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 131.9°C |
| Boiling Point: | 280°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 131.9°C |
| Safety Data | |
 |
|
