| Identification |
| Name: | poly-S-benzyl-L-cysteine mol wt*2000-10000 |
| Synonyms: | Poly-S-benzylcysteine;Poly-S-benzyl-L-cysteine;L-Cysteine, S-(phenylmethyl)-, homopolymer |
| CAS: | 25988-62-9 |
| Molecular Formula: | [C10H13NO2S2]n |
| Molecular Weight: | 211.28072 |
| InChI: | InChI=1S/C10H13NO2S/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-/m0/s1 |
| Molecular Structure: |
![([C10H13NO2S2]n) Poly-S-benzylcysteine;Poly-S-benzyl-L-cysteine;L-Cysteine, S-(phenylmethyl)-, homopolymer](https://img.guidechem.com/pic/image/25988-62-9.gif) |
| Properties |
| Water Solubility: | Stability Stable. Store cool. Incompatible with strong oxidizing agents. Toxicology Toxicology not fully investigated. Toxicity data (The meaning of any toxicol |
| Solubility: | Stability Stable. Store cool. Incompatible with strong oxidizing agents. Toxicology Toxicology not fully investigated. Toxicity data (The meaning of any toxicol |
| Appearance: | solid |
| Safety Data |
| |
 |
