| Identification | |
| Name: | Benzene, 2,4-diisocyanato-1-methyl-, homopolymer |
| Synonyms: | POLY(TOLYLENE 2,4-DIISOCYANATE);2,4-diisocyanato-1-methyl-benzenhomopolymer;2,4-Toluenediisocyanate,homopolymer;Benzene,2,4-diisocyanato-1-methyl-,homopolymer;Poly(tolylene 2,4-diisocyanate) solution;POLY(TOLYLENE 2,4-DIISOCYANATE), 50 WT. % SOLUTION IN BUTYL ACETATE;2,4-DISOCYANATO-1-METHYLBENZENE, HOMOPLOYMER;toluene-2,4-diisocyanate homopolymer |
| CAS: | 26006-20-2 |
| Molecular Formula: | C9H6N2O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C9H6N2O2/c1-7-2-3-8(10-5-12)4-9(7)11-6-13/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1866 3/PG 3 |
| Melting Point: | 19.5-21.5 deg C |
| Flash Point: | 166°C |
| Boiling Point: | 386.8°Cat760mmHg |
| Density: | 1.05g/cm3 |
| Refractive index: | n20/D 1.501 |
| Solubility: | Miscible with alcohol (decomposition). Miscible with ether, acetone, benzene, carbon tetrachloride, chlorobenzene, diglycol monomethyl ether, kerosene, olive oil; sol in ethyl acetate. |
| Flash Point: | 166°C |
| Color: | A WATER-WHITE LIQ WHICH TURNS STRAW-COLORED ON STANDING Clear to light yellow liq or crystals Colorless to pale yellow, solid or liquid (above 71 deg F). |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
