| Identification | |
| Name: | 6-Chloropyridine-3,4-diamine hydrochloride |
| Synonyms: | 3,4-Pyridinediamine, 6-chloro-, hydrochloride (1:1);6-Chloropyridine-3,4-diamine HCl;6-Chloro-3,4-pyridinediamine HCl; |
| CAS: | 2604-40-2 |
| Molecular Formula: | C5H6ClN3.HCl |
| Molecular Weight: | 180.03518 |
| InChI: | InChI=1/C5H6ClN3.ClH/c6-5-1-3(7)4(8)2-9-5;/h1-2H,8H2,(H2,7,9);1H |
| Molecular Structure: |  |
| Properties | |
| Specification: |
The 6-Chloropyridine-3,4-diamine hydrochloride with the cas number 2604-40-2, is also called 3,4-Pyridinediamine, 6-chloro-, hydrochloride (1:1) .The product category of this chemical is Pyridine.This product can be supplied by the following suppliers: (1)Capot Chemical Co., Ltd.; (2)hangzhouTitanChemicalCo.,Ltd.; (3)Shenyang longbang international Trading Co.Ltd.; (4)Shanghai Fchemicals Technology Co., Ltd.; (5)ChangChem Co., Ltd.; (6)Nanjing Eden New Pharmaceutical Technology Co., Ltd.; (7)Ark Pharm, Inc. ; (8)CARBONE SCIENTIFIC CO.,LTD.. You can still convert the following datas into molecular structure : |
| Safety Data | |
 |
|
