Identification |
Name: | Benzothiazole,2-chloro-6-methoxy- |
Synonyms: | 2-Chloro-6-methoxy-1,3-benzothiazole;2-Chloro-6-methoxybenzo[d]thiazole;6-Methoxy-2-chlorobenzothiazole;NSC 118120; |
CAS: | 2605-14-3 |
Molecular Formula: | C8H6ClNOS |
Molecular Weight: | 199.66 |
InChI: | InChI=1/C8H6ClNOS/c1-11-5-2-3-6-7(4-5)12-8(9)10-6/h2-4H,1H3 |
Molecular Structure: |
|
Properties |
Melting Point: | 52-56 ºC |
Flash Point: | 110 ºC |
Boiling Point: | 133 °C / 7mmHg |
Density: | 1.404g/cm3 |
Refractive index: | 1.654 |
Specification: | Safety Statements:22-26 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice |
Flash Point: | 110 ºC |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
|