Identification |
Name: | D-Streptamine,O-3-deoxy-4-C-methyl-3-(methylamino)-b-L-arabinopyranosyl-(1®6)-O-[2,6-diamino-2,3,4,6-tetradeoxy-a-D-erythro-hexopyranosyl-(1®4)]-2-deoxy- |
Synonyms: | GentamycinC1a (8CI); Geneticin C1a; Gentamicin C1a; Gentamicin C3 |
CAS: | 26098-04-4 |
Molecular Formula: | C19H39 N5 O7 |
Molecular Weight: | 449.545 |
InChI: | InChI=1/C19H39N5O7/c1-19(27)7-28-18(13(26)16(19)24-2)31-15-11(23)5-10(22)14(12(15)25)30-17-9(21)4-3-8(6-20)29-17/h8-18,24-27H,3-7,20-23H2,1-2H3 |
Molecular Structure: |
|
Properties |
Melting Point: | 102-1080C |
Flash Point: | 362.1°C |
Boiling Point: | 675.2°C at 760 mmHg |
Density: | 1.36g/cm3 |
Refractive index: | 1.603 |
Flash Point: | 362.1°C |
Usage: | Antibiotic complex consists of three closely related components, gentamicins C1, C2, C1a, and also gentamicin A which differs from the other members of the complex but is similar to kanamycin C |
Safety Data |
|
|