| Identification |
| Name: | 2-Pyrrolidinemethanamine,1-ethyl- |
| Synonyms: | Pyrrolidine,2-(aminomethyl)-1-ethyl- (7CI,8CI);(1-Ethyl-2-pyrrolidinyl)methylamine;1-(1-Ethylpyrrolidin-2-yl)methanamine;1-Ethyl-2-(aminomethyl)pyrrolidine;1-Ethyl-2-pyrrolidinemethylamine;2-(Aminomethyl)-N-ethylpyrrolidine;N-Ethyl-2-(aminomethyl)pyrrolidine; |
| CAS: | 26116-12-1 |
| EINECS: | 247-466-3 |
| Molecular Formula: | C7H16N2 |
| Molecular Weight: | 128.22 |
| InChI: | InChI=1/C7H16N2/c1-2-9-5-3-4-7(9)6-8/h7H,2-6,8H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Density: | 0.887 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.466 |
| Solubility: | Very soluble |
| Appearance: | clear yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
