| Identification |
| Name: | Butanedioic acid, methylene-, polymer with ethyl 2-propenoate |
| Synonyms: | Butanedioic acid, methylene-, polymer with ethyl 2-propenoate;Ethyl acrylate, itaconic acid polymer;methylene-butanedioic aci polymer with ethyl 2-propenoate;methylene-butanedioic aci polymer with ethyl2-propenoate |
| CAS: | 26124-80-1 |
| Molecular Formula: | C10H14O6 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C5H6O4.C5H8O2/c1-3(5(8)9)2-4(6)7;1-3-5(6)7-4-2/h1-2H2,(H,6,7)(H,8,9);3H,1,4H2,2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 198.7°C |
| Boiling Point: | 381.4°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 198.7°C |
| Safety Data |
| |
 |
