| Identification | |
| Name: | Propanoic acid,2-[4-(4-chlorophenoxy)phenoxy]- |
| Synonyms: | Propionicacid, 2-[p-(p-chlorophenoxy)phenoxy]- (8CI);2-[4-(4-Chlorophenoxy)phenoxy]propionic acid; Clofop; HCG 004; HOE 19453; LF479 |
| CAS: | 26129-32-8 |
| EINECS: | 255-626-9 |
| Molecular Formula: | C15H13 Cl O4 |
| Molecular Weight: | 292.73 |
| InChI: | InChI=1/C15H13ClO4/c1-10(15(17)18)19-12-6-8-14(9-7-12)20-13-4-2-11(16)3-5-13/h2-10H,1H3,(H,17,18) |
| Molecular Structure: | ![(C15H13ClO4) Propionicacid, 2-[p-(p-chlorophenoxy)phenoxy]- (8CI);2-[4-(4-Chlorophenoxy)phenoxy]propionic acid; C...](https://img1.guidechem.com/chem/e/dict/190/26129-32-8.jpg) |
| Properties | |
| Density: | 1.306 g/cm3 |
| Refractive index: | 1.584 |
| Specification: |
2-[4-(4-chlorophenoxy)phenoxy]propanoic acid ,its cas register number is 26129-32-8.It also can be called Fenofibric acid potassium salt ; Fenofibric acid ; fenofibric acid sodium salt ; Fenofibric acid, (R)-isomer ; Propanoic acid, 2-[4-(4-chlorophenoxy)phenoxy]- and (RS)-2-[4-(4-Chlorophenoxy)phenoxy]propionic Acid . |
| Safety Data | |
 |
|
