Identification |
Name: | Xylene Formaldehyde Resin |
Synonyms: | Formaldehyde, polymer with 1,3-dimethylbenzene;Formaldehyde,polymer with 1,3-dimethylbenzene;Xylene formaldehyde resin |
CAS: | 26139-75-3 |
Molecular Formula: | C9H12O |
Molecular Weight: | 136.19098 |
InChI: | InChI=1S/C8H10.CH2O/c1-7-4-3-5-8(2)6-7;1-2/h3-6H,1-2H3;1H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 163oC |
Density: | g/cm3 |
Water Solubility: | ether, benzene,n-hexane,MEK methanol |
Solubility: | ether, benzene,n-hexane,MEK methanol |
Appearance: | Colorless liquid |
Flash Point: | 163oC |
Safety Data |
|
 |