| Identification | |
| Name: | Butanal, methyl- |
| Synonyms: | Butyraldehyde,methyl- (8CI); Methylbutanal |
| CAS: | 26140-47-6 |
| Molecular Formula: | C5H10 O |
| Molecular Weight: | 86.1323 |
| InChI: | InChI=1S/C5H10O/c1-5(2)3-4-6/h4-5H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -51 deg C |
| Flash Point: | °C |
| Boiling Point: | 93.5°Cat760mmHg |
| Density: | 0.791g/cm3 |
| Solubility: | Slightly soluble in water; soluble in ethanol, ethyl ether Miscible with alcohol, ether SOL IN PROPYLENE GLYCOL AND OILS In water, 1,400 mg/L at 20 deg C |
| Flash Point: | °C |
| Color: | Colorless liquid |
| Safety Data | |
 |
|
