| Identification | |
| Name: | 5-Chloro-2-methyl-4-isothiazolin-3-one |
| Synonyms: | Isothiazolinones(Blend of CMIT and MIT);Kathon CG 5243;Isothiazolinone Anti-mould Antiseptic;Kasong preservative;Isothiazolinones;5-Chloro-2-methyl-4-isothiazolin-3-one (CMI);5-Chloro-2-Methyl-4-Isothiazoline-3-One; |
| CAS: | 26172-55-4 |
| EINECS: | 247-500-7 |
| Molecular Formula: | C4H4ClNOS |
| Molecular Weight: | 149.59 |
| InChI: | InChI=1/C4H4ClNOS/c1-6-4(7)2-3(5)8-6/h2H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Density: | 1.25 (14% aq.) |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.378 |
| Appearance: | Clear to yellow liquid |
| Specification: |
?5-Chloro-2-methyl-4-isothiazolin-3-one , its cas register number is 26172-55-4. It also can be called?4-Isothiazolin-3-one, 5-chloro-2-methyl- ; Methylchloroisothiazolinone?; 3(2H)-Isothiazolone, 5-chloro-2-methyl- ; 4-Isothiazolin-3-one, 5-chloro-2-methyl- ; 5-Chloro-2-methyl-2H-isothiazol-3-one .It is a?liquid and is a cost-effective antimicrobial. It is a high performance biocide for preserving metal working fluids, hydraulic fluids, polymer emulsions, pigment dispersions. |
| Packinggroup: | III |
| Usage: | Isocil(R) is a cost-effective antimicrobial. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
