| Identification | |
| Name: | 3-Pyrrolidinecarboxylicacid, 4-(1-methylethyl)-, (3R,4R)-rel- |
| Synonyms: | 3-Pyrrolidinecarboxylicacid,4-(1-methylethyl)-,(3R,4R)-rel-(9CI) |
| CAS: | 261896-36-0 |
| Molecular Formula: | C8H15 N O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H15NO2/c1-5(2)6-3-9-4-7(6)8(10)11/h5-7,9H,3-4H2,1-2H3,(H,10,11)/t6-,7+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 117.594°C |
| Boiling Point: | 270.829°C at 760 mmHg |
| Density: | 1.054g/cm3 |
| Refractive index: | 1.472 |
| Specification: |
The (3R,4R)-4-Isopropylpyrrolidine-3-carboxylic acid with the cas number 261896-36-0 is also called 3-Pyrrolidinecarboxylicacid, 4-(1-methylethyl)-, (3R,4R)-rel-. The systematic name is (3R,4R)-4-(propan-2-yl)pyrrolidine-3-carboxylic acid. Its molecular formula is C8H15NO2. This chemical belongs to the following product categories: (1)isopropyl; (2)carboxylicacid. The properties of the chemical are: (1)ACD/LogP: 1.06; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 49.33 Å2; (7)Index of Refraction: 1.472; (8)Molar Refractivity: 41.767 cm3; (9)Molar Volume: 149.108 cm3; (10)Polarizability: 16.558×10-24cm3; (11)Surface Tension: 35.964 dyne/cm; (12)Enthalpy of Vaporization: 56.027 kJ/mol; (13)Vapour Pressure: 0.002 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 117.594°C |
| Safety Data | |
 |
|
