| Identification | |
| Name: | tricyclohexylphosphine |
| Synonyms: | Phosphine,tricyclohexyl-;Tricyclohexylphosphine;tricyclohexylphosphine); |
| CAS: | 2622-14-2 |
| EINECS: | 220-069-2 |
| Molecular Formula: | C18H33P |
| Molecular Weight: | 280.43 |
| InChI: | InChI=1/C18H33P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h16-18H,1-15H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Flash Point: | 195.6 ºC |
| Boiling Point: | 383.4 ºC at 760 mmHg |
| Density: | 0.909 g/mL at 25 ºC |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Appearance: | white to yellow crystalline powder |
| Specification: |
Tricyclohexyl phosphine (CAS NO.2622-14-2), its Synonyms are Phosphine, tricyclohexyl- ; Tricyclohexyl-phosphin ; Tricyclohexylphosphan . It is clear colorless to pale yellow solution. |
| Packinggroup: | III |
| Flash Point: | 195.6 ºC |
| Storage Temperature: | −20°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
