| Identification | |
| Name: | Benzene, dibromo- |
| Synonyms: | Dibromobenzene |
| CAS: | 26249-12-7 |
| EINECS: | 247-544-7 |
| Molecular Formula: | C6H4 Br2 |
| Molecular Weight: | 235.92 |
| InChI: | InChI=1/C6H4Br2/c7-5-3-1-2-4-6(5)8/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 95.5°C |
| Boiling Point: | 225.4°C at 760 mmHg |
| Density: | 1.936g/cm3 |
| Refractive index: | 1.599 |
| Specification: |
Dibromobenzene ,its cas register number is 26249-12-7. It also can be called 1,2-Dibromobenzene ; ortho-Dibromobenzene ;and Benzene, 1,2-dibromo- . It is very unreactive, and will be easily ignited by heat, sparks or flames. Vapors may form explosive mixtures with air. Reactivity generally decreases with increased degree of substitution of halogen for hydrogen atoms. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 95.5°C |
| Safety Data | |
 |
|
