| Identification | |
| Name: | 2,1,3-Benzoselenadiazole,5,6-dimethyl- |
| Synonyms: | 5,6-Dimethyl-2,1,3-benzoselenadiazole;NSC 84202 |
| CAS: | 2626-34-8 |
| Molecular Formula: | C8H8 N2 Se |
| Molecular Weight: | 211.14 |
| InChI: | InChI=1/C8H8N2Se/c1-5-3-7-8(4-6(5)2)10-11-9-7/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 130°C |
| Boiling Point: | 291.4°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
5,6-Dimethyl-2,1,3-benzoselenodiazole , its cas register number is 2626-34-8. It also can be called BRN 1072761 ; NSC 84202 . When 5,6-Dimethyl-2,1,3-benzoselenodiazole (CAS NO.2626-34-8) is heated to decomposition, it emits toxic fumes of NOx and Se. |
| Flash Point: | 130°C |
| Safety Data | |
 |
|
