| Identification | |
| Name: | 6-Benzothiazolol,2-amino-, hydrochloride (1:1) |
| Synonyms: | 6-Benzothiazolol,2-amino-, monohydrochloride (8CI,9CI);2-Amino-6-benzothiazolol hydrochloride; |
| CAS: | 26278-78-4 |
| Molecular Formula: | C7H6N2OS.HCl |
| Molecular Weight: | 202.66 |
| InChI: | InChI=1/C7H6N2OS.ClH/c8-7-9-5-2-1-4(10)3-6(5)11-7;/h1-3,10H,(H2,8,9);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 201.3°C |
| Boiling Point: | 409.2°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
The 2-Amino-6-benzothiazolol hydrochloride with the cas number 26278-78-4 is also called 6-Benzothiazolol,2-amino-, hydrochloride (1:1). Both the systematic name and IUPAC name are 2-amino-1,3-benzothiazol-6-ol hydrochloride. Its molecular formula is C7H6N2OS.HCl. The product's category is pharmacetical. The properties of the chemical are: (1)ACD/LogP: 1.16; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 3; (4)#H bond donors: 3; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 87.38 Å2; (7)Flash Point: 201.3 °C; (8)Enthalpy of Vaporization: 68.71 kJ/mol; (9)Boiling Point: 409.2 °C at 760 mmHg; (10)Vapour Pressure: 2.79×10-7 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 201.3°C |
| Safety Data | |
 |
|
