| Identification | |
| Name: | Phenol, 4-ethenyl- |
| Synonyms: | Phenol,p-vinyl- (6CI,7CI,8CI);4-Ethenylphenol;4-Hydroxystyrene;4-Vinylphenol;p-Hydroxystyrene;p-Vinylphenol; |
| CAS: | 2628-17-3 |
| EINECS: | 220-103-6 |
| Molecular Formula: | C8H8O |
| Molecular Weight: | 120.15 |
| InChI: | InChI=1/C8H8O/c1-2-7-3-5-8(9)6-4-7/h2-6,9H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 92.3°C |
| Boiling Point: | 206.2°Cat760mmHg |
| Density: | 1.055g/cm3 |
| Refractive index: | 1.4440 |
| Specification: |
4-Vinylphenol (2628-17-3) also can be called Poly(4-vinylphenol) ; 4-Hydroxystyrene ; 4-Ethenylphenol ; Poly(p-vinylphenol) and phenol, 4-ethenyl- . |
| Flash Point: | 92.3°C |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
