Identification |
Name: | 1,3-Isobenzofurandione, polymer with 2,5-furandione and oxybis[propanol] |
Synonyms: | 1,3-Isobenzofurandione, polymer with 2,5-furandione and oxybis[propanol] |
CAS: | 26301-25-7 |
Molecular Formula: | C18H20O9 |
Molecular Weight: | 0 |
InChI: | InChI=1/C8H4O3.C6H14O3.C4H2O3/c9-7-5-3-1-2-4-6(5)8(10)11-7;1-5(7)3-9-4-6(2)8;5-3-1-2-4(6)7-3/h1-4H;5-8H,3-4H2,1-2H3;1-2H |
Molecular Structure: |
![(C18H20O9) 1,3-Isobenzofurandione, polymer with 2,5-furandione and oxybis[propanol]](https://img.guidechem.com/crawlimg/26301-25-7.png) |
Properties |
Flash Point: | 139.7°C |
Boiling Point: | 295°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 139.7°C |
Safety Data |
|
 |