| Identification |
| Name: | Benzoic acid, 4-pentyl- |
| Synonyms: | Benzoicacid, p-pentyl- (8CI);4-Amylbenzoic acid;4-n-Pentylbenzoic acid;NSC 169024;p-Amylbenzoic acid;p-Pentylbenzoic acid; |
| CAS: | 26311-45-5 |
| EINECS: | 247-607-9 |
| Molecular Formula: | C12H16O2 |
| Molecular Weight: | 192.26 |
| InChI: | InChI=1/C12H16O2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9H,2-5H2,1H3,(H,13,14) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.043 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | White crystalline powder. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
