| Identification | |
| Name: | Magnesium,bromo(2,4,6-trimethylphenyl)- |
| Synonyms: | Magnesium,bromomesityl- (7CI,8CI);Mesitylmagnesium bromide (6CI);2,4,6-Trimethylphenylmagnesium bromide;Bromo(2,4,6-trimethylphenyl)magnesium;Bromomesitylmagnesium;Mesitymagnesium bromide; |
| CAS: | 2633-66-1 |
| Molecular Formula: | C9H11BrMg |
| Molecular Weight: | 223.39 |
| InChI: | InChI=1/C9H11.BrH.Mg/c1-7-4-8(2)6-9(3)5-7;;/h4-5H,1-3H3;1H;/q;;+1/p-1/rC9H11Mg.BrH/c1-6-4-7(2)9(10)8(3)5-6;/h4-5H,1-3H3;1H/q+1;/p-1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3399 4.3/PG 1 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: | Safety Statements:45-36/37/39-26-16 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | I |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols | |
 |
|
