| Identification | |
| Name: | 1,3-Benzodioxole,5-bromo- |
| Synonyms: | Benzene,4-bromo-1,2-(methylenedioxy)- (6CI,7CI,8CI);1-Bromo-3,4-(methylenedioxy)benzene;3,4-Methylenedioxybromobenzene;3,4-Methylenedioxyphenyl bromide;5-Bromo-1,3-benzodioxolane;5-Bromo-1,3-benzodioxole;Benzodioxol-5-yl bromide; |
| CAS: | 2635-13-4 |
| EINECS: | 220-123-5 |
| Molecular Formula: | C7H5BrO2 |
| Molecular Weight: | 201.02 |
| InChI: | InChI=1/C7H5BrO2/c8-5-1-2-6-7(3-5)10-4-9-6/h1-3H,4H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.669 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.582-1.584 |
| Appearance: | colourless to plae orange Liquid |
| Specification: |
1,3-Benzodioxole, 5-bromo- (CAS NO.2635-13-4) is also called as 4-Bromomethylenedioxybenzene ; 1,2-Methylenedioxy-4-bromobenzene ; 1-Bromo-3,4-(methylenedioxy)benzene ; 3,4-Methylenedioxybromobenzene ; 3,4-Methylendioxybromobenzene ; 4-Bromo-1,2-methylenedioxybenzene . 1,3-Benzodioxole, 5-bromo- (CAS NO.2635-13-4) is used as intermediates of daily chemical products. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
