Identification |
Name: | 2-Propenoic acid,esters,butyl ester,polymer with 1-(ethenyloxy)-2-methylpropane |
Synonyms: | 2-Propenoic acid, butyl ester, polymer with 1-(ethenyloxy)-2-methylpropane |
CAS: | 26354-08-5 |
Molecular Formula: | C13H24O3 |
Molecular Weight: | 0 |
InChI: | InChI=1/C7H12O2.C6H12O/c1-3-5-6-9-7(8)4-2;1-4-7-5-6(2)3/h4H,2-3,5-6H2,1H3;4,6H,1,5H2,2-3H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 39.4°C |
Boiling Point: | 145.9°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 39.4°C |
Safety Data |
|
 |