| Identification | |
| Name: | 2(1H)-Quinolinethione |
| Synonyms: | Carbostyril,thio- (6CI,7CI,8CI);2-Mercaptoquinoline;2-Quinolinethiol;2-Quinolinethione;2-Thioquinoline;2-Thioquinolone;NSC 408468;NSC 43642;Thiocarbostyril; |
| CAS: | 2637-37-8 |
| EINECS: | 220-132-4 |
| Molecular Formula: | C9H7 N S |
| Molecular Weight: | 161.23 |
| InChI: | InChI=1/C9H7NS/c11-9-6-5-7-3-1-2-4-8(7)10-9/h1-6H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 174-176 °C(lit.) |
| Flash Point: | 111.7°C |
| Boiling Point: | 261.1°Cat760mmHg |
| Density: | 1.27g/cm3 |
| Refractive index: | 1.707 |
| Specification: |
2-Quinolinethiol ,its cas register number is 2637-37-8. It also can be called 2(1H)-Quinolinethione ; and Carbostyril, thio- (VAN) (8CI) . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 111.7°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
