Identification |
Name: | 4H-1-Benzopyran-4-one-3,6,8-d3,5,7-dihydroxy-2-(4-hydroxyphenyl-3,5-d2)- |
Synonyms: | [3,6,8,3',5'-D5]-Apigenin |
CAS: | 263711-74-6 |
Molecular Formula: | C15H5 D5 O5 |
Molecular Weight: | 0 |
InChI: | InChI=1/C15H10O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-7,16-18H/i3D,4D,5D,6D,7D |
Molecular Structure: |
![(C15H5D5O5) [3,6,8,3',5'-D5]-Apigenin](https://img1.guidechem.com/chem/e/dict/6/263711-74-6.jpg) |
Properties |
Flash Point: | 217.064°C |
Boiling Point: | 555.505°C at 760 mmHg |
Density: | 1.577g/cm3 |
Refractive index: | 1.732 |
Appearance: | Pale Yellow Crystalline Solid |
Flash Point: | 217.064°C |
Usage: | The labelled aglucon of apiin and of apigenin-7-glucoside |
Safety Data |
|
 |