| Identification | |
| Name: | Butanoic acid, hexylester |
| Synonyms: | Butyricacid, hexyl ester (6CI,7CI,8CI);1-Hexyl butyrate;Hexyl butanoate;Hexylbutyrate;n-Hexyl butanoate;n-Hexyl butyrate;n-Hexyl n-butyrate; |
| CAS: | 2639-63-6 |
| EINECS: | 220-136-6 |
| Molecular Formula: | C10H20O2 |
| Molecular Weight: | 172.26 |
| InChI: | InChI=1/C10H20O2/c1-3-5-6-7-9-12-10(11)8-4-2/h3-9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3272 |
| Flash Point: | 178? |
| Density: | 0.851 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.417 |
| Solubility: | Insoluble |
| Appearance: | colourless to pale yellow liquid with a fruity, apricot odour |
| Specification: |
The chemical synonyms of Hexyl butanoate (2639-63-6) are 1-Hexyl butyrate ; 1-Hexylbutyrate ; Butanoicacid,hexylester ; n-Hexyl butanoate ; n-Hexyl n-butyrate ; n-Hexylbutanoate ; Fema 2568 ; Hexyl butanoate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 178? |
| Storage Temperature: | Keep tightly closed. Keep away from heat and open flame. |
| Usage: | Flavoring agent. |
| Safety Data | |
 |
|
