| Identification | |
| Name: | Monocaprylin |
| Synonyms: | octanoic acid, monoester with glycerol;Imwitor 308;Sunsoft 700p2;Octanoic acid,esters,monoester with 1,2,3-propanetriol;Poem M 100;Sefsol 318; |
| CAS: | 26402-26-6 |
| EINECS: | 247-668-1 |
| Molecular Formula: | C11H22O4 |
| Molecular Weight: | 218.29 |
| InChI: | InChI=1/C11H22O4/c1-2-3-4-5-6-7-11(14)15-9-10(13)8-12/h10,12-13H,2-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 123.4°C |
| Boiling Point: | 340°C at 760 mmHg |
| Density: | 1.044g/cm3 |
| Refractive index: | 1.465 |
| Flash Point: | 123.4°C |
| Safety Data | |
 |
|
