Identification |
Name: | 2-Propenoic acid, ethyl ester, polymer with ethenyl chloroacetate |
Synonyms: | 2-Propenoic acid, ethyl ester, polymer with ethenyl chloroacetate |
CAS: | 26426-73-3 |
Molecular Formula: | C9H13ClO4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C5H8O2.C4H5ClO2/c1-3-5(6)7-4-2;1-2-7-4(6)3-5/h3H,1,4H2,2H3;2H,1,3H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 15.6°C |
Boiling Point: | 99.5°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 15.6°C |
Safety Data |
|
 |