| Identification | |
| Name: | Naphthaleneacetic acid |
| Synonyms: | Aids017630;Aids-017630 |
| CAS: | 26445-01-2 |
| Molecular Formula: | C12H10 O2 |
| Molecular Weight: | 186.2066 |
| InChI: | InChI=1S/C12H10O2/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 134.5-135.5 deg C |
| Flash Point: | 270.1°C |
| Boiling Point: | 373.2°Cat760mmHg |
| Density: | 1.233g/cm3 |
| Solubility: | Slightly soluble in ethanol, trifluoroacetic acid; soluble in benzene and acetic acid; very soluble in ethyl ether, acetone, and chloroform. 10.6 mg/l in carbon tetrachloride @ 26 deg C; 55 mg/l in xylene at 26 deg C About 30 parts in alcohol Very sol in isopropanol In water, 420 mg/l @ 20 deg C |
| Flash Point: | 270.1°C |
| Color: | Needles from water White crystals Colorless crystals |
| Safety Data | |
 |
|
