| Identification |
| Name: | Oxirane,2-[(methylphenoxy)methyl]- |
| Synonyms: | Oxirane,[(methylphenoxy)methyl]- (9CI); Propane, 1,2-epoxy-3-(tolyloxy)- (6CI,7CI,8CI);Araldite DY 023; Cresol glycidyl ether; Cresyl glycidyl ether; DY 023; Epodil472; Erisys GE 10; Glycidyl methylphenyl ether; Glycidyl tolyl ether;Methylphenyl glycidyl ether; Tolyl glycidyl ether |
| CAS: | 26447-14-3 |
| EINECS: | 247-711-4 |
| Molecular Formula: | C10H12 O2 |
| Molecular Weight: | 164.20108 |
| InChI: | InChI=1/C10H12O2/c1-8-2-4-9(5-3-8)11-6-10-7-12-10/h2-5,10H,6-7H2,1H3/t10-/m1/s1 |
| Molecular Structure: |
![(C10H12O2) Oxirane,[(methylphenoxy)methyl]- (9CI); Propane, 1,2-epoxy-3-(tolyloxy)- (6CI,7CI,8CI);Araldite DY 0...](https://img1.guidechem.com/chem/e/dict/164/26447-14-3.jpg) |
| Properties |
| Transport: | UN 3082 9 |
| Density: | 1.14 |
| Stability: | Stable. Incompatible with strong acids, bases and oxidizing agents. May attack some types of plastic. Combustible. |
| Refractive index: | 1.533 |
| Water Solubility: | | |
| Solubility: | <=0.1 g/100 mL at 21 oC in water |
| Appearance: | colourless liquid |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |
