| Identification |
| Name: | 4,4-Dimethyl-1-phenyl-3-pyrazolidone |
| Synonyms: | 4,4-Dimethyl-1-phenyl-3-pyrazolidinone |
| CAS: | 2654-58-2 |
| EINECS: | 220-181-1 |
| Molecular Formula: | C11H14N2O |
| Molecular Weight: | 190.24 |
| InChI: | InChI=1/C11H14N2O/c1-11(2)8-13(12-10(11)14)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,12,14) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.087 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.537 |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | white to light orange or pink crystalline powder |
| Packinggroup: | II |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Photographic film developer. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
